BD9539547
(4-Chlorophenyl)(cyclopropyl)methanone , 98% , 6640-25-1
CAS NO.:6640-25-1
Empirical Formula: C10H9ClO
Molecular Weight: 180.63
MDL number: MFCD00001295
EINECS: 229-655-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB37.60 | In Stock |
|
| 5g | RMB126.40 | In Stock |
|
| 25g | RMB404.80 | In Stock |
|
| 100g | RMB1354.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 29-31 °C(lit.) |
| Boiling point: | 135-137°C 10mm |
| Density | 1.16 |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow to Orange |
| BRN | 2044845 |
| InChI | InChI=1S/C10H9ClO/c11-9-5-3-8(4-6-9)10(12)7-1-2-7/h3-7H,1-2H2 |
| InChIKey | OPSFCTBBDIDFJM-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(Cl)C=C1)(C1CC1)=O |
| CAS DataBase Reference | 6640-25-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Chlorophenyl cyclopropyl ketone(6640-25-1) |
Description and Uses
4-Chlorophenylcyclopropyl ketone is an intermediate for the insecticide flucyclourea and is also used to synthesize cyclopropyl-4-chlorobenzophenone oxime-o-(3-phenoxybenzyl) ether, a novel pyrethroid pesticide with high biological activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 2914790090 |



