BD9539631
Ethyl 4-(((benzyl(4-(ethoxycarbonyl)phenyl)amino)methylene)amino)benzoate , 95+% , 586400-06-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB492.80 | In Stock |
|
| 25g | RMB1144.00 | In Stock |
|
| 100g | RMB2635.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 581.8±60.0 °C(Predicted) |
| Density | 1.11 |
| storage temp. | 2-8°C |
| pka | 5?+-.0.50(Predicted) |
| InChI | InChI=1S/C26H26N2O4/c1-3-31-25(29)21-10-14-23(15-11-21)27-19-28(18-20-8-6-5-7-9-20)24-16-12-22(13-17-24)26(30)32-4-2/h5-17,19H,3-4,18H2,1-2H3 |
| InChIKey | WHRPFDOAMQIPQF-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C1=CC=C(N(C=NC2=CC=C(C(OCC)=O)C=C2)CC2=CC=CC=C2)C=C1 |
Description and Uses
N, N'-bis(4-ethoxycarbonylphenyl)-N-benzylformamidine is an important ultraviolet absorber. Adding this ultraviolet absorber to the synthesis process of various organic materials such as plastic products, resin products, cosmetics, fuels, textiles, etc. can avoid the destruction of the physical properties of the synthetic products caused by the photodegradation of ultraviolet rays (such as product discoloration, fading, or brittleness and cracking).
N,N'-Bis(4-ethoxycarbonylphenyl)-N-benzylformamidine is mainly used as an ultraviolet absorber.



