PRODUCT Properties
| Melting point: | 9.0 °C |
| Boiling point: | 120 °C/750 mmHg (lit.) |
| Density | 1.514 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 110 °F |
| solubility | Chloroform, Ethyl Acetate (Sparingly) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Stability: | Volatile |
| InChI | InChI=1S/C9H3F9/c10-7(11,12)4-1-5(8(13,14)15)3-6(2-4)9(16,17)18/h1-3H |
| InChIKey | ZMAUHKSOLPYPDB-UHFFFAOYSA-N |
| SMILES | C1(C(F)(F)F)=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 729-81-7(CAS DataBase Reference) |
Description and Uses
1,3,5-tris(trifluoromethyl)benzene was used as a starting material in the synthesis of bis(2,4,6-tris(trifluoromethyl)phenyl)chloropnictines.
It may be used as a starting material in the synthesis of 2,4,6-tris(trifluoromethyl)benzoic acid by reacting with n-butyllithium and carbon dioxide and in the synthesis of lithio derivative, via direct metalation with n-butyllithium.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P233-P240-P241-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | Xi,F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
