BD9573931
6,6-Dimethyl-3-azabicyclo[3.1.0]hexane , 97% , 943516-54-9
CAS NO.:943516-54-9
Empirical Formula: C7H13N
Molecular Weight: 111.18
MDL number: MFCD13176114
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB24.00 | In Stock |
|
| 250mg | RMB28.80 | In Stock |
|
| 1g | RMB35.20 | In Stock |
|
| 5g | RMB76.00 | In Stock |
|
| 10g | RMB146.40 | In Stock |
|
| 25g | RMB317.60 | In Stock |
|
| 100g | RMB1248.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 135℃ |
| Density | 0.911 |
| Flash point: | 24℃ |
| storage temp. | 2-8°C(protect from light) |
| pka | 11.51±0.40(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C7H13N/c1-7(2)5-3-8-4-6(5)7/h5-6,8H,3-4H2,1-2H3 |
| InChIKey | BGOMFPZIMJCRDV-UHFFFAOYSA-N |
| SMILES | C12C(C1(C)C)CNC2 |
Description and Uses
6,6-DiMethyl-3-azabicyclo[3.1.0]hexane Boceprevir is a Key interMediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P305+P351+P338 |
| RIDADR | 1993 |
| HazardClass | 3 |
| PackingGroup | Ⅱ |
| HS Code | 2933998090 |

![6,6-Dimethyl-3-azabicyclo[3.1.0]hexane](https://img.chemicalbook.com/CAS/GIF/943516-54-9.gif)

![6,6-Dimethyl-3-azabicyclo[3.1.0]hexanehydrochloride](https://img.chemicalbook.com/CAS/GIF/943516-55-0.gif)
![6,6-Dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione](https://img.chemicalbook.com/CAS/GIF/194421-56-2.gif)