BD9589231
Methyl 2-ethoxy-1H-benzo[d]imidazole-7-carboxylate , 98% , 150058-27-8
CAS NO.:150058-27-8
Empirical Formula: C11H12N2O3
Molecular Weight: 220.22
MDL number: MFCD14636510
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB28.80 | In Stock |
|
| 5g | RMB55.20 | In Stock |
|
| 10g | RMB89.60 | In Stock |
|
| 25g | RMB187.20 | In Stock |
|
| 100g | RMB622.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 373.1±34.0 °C(Predicted) |
| Density | 1.269 |
| storage temp. | 2-8°C |
| solubility | soluble in Chloroform, Methanol |
| form | Solid |
| pka | 8.99±0.30(Predicted) |
| color | Dark Reddish Orange to Dark Brown |
| InChI | InChI=1S/C11H12N2O3/c1-3-16-11-12-8-6-4-5-7(9(8)13-11)10(14)15-2/h4-6H,3H2,1-2H3,(H,12,13) |
| InChIKey | MOPLKVMMSFGZIR-UHFFFAOYSA-N |
| SMILES | C1(OCC)NC2=C(C(OC)=O)C=CC=C2N=1 |
Description and Uses
An intermediate in the preparation of labelled Candesartan.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |

![Methyl 2-ethoxy-1H-benzo[d]imidazole-7-carboxylate](https://img.chemicalbook.com/CAS/GIF/150058-27-8.gif)

![Methyl 1-((2'-(2H-tetrazol-5-yl)-[1,1'-biphenyl]-4-yl)methyl)-2-ethoxy-1H-benzo[d]imidazole-7-carboxylate](https://img.chemicalbook.com/CAS/GIF/139481-69-9.gif)
![Ethyl-3-Amino-2-[(2'-Cyanoiphenyl-4-yl)Methyl]-AminoBenzoate](https://img.chemicalbook.com/CAS/GIF/136285-69-3.gif)

![Methyl2-(((2'-cyano-[1,1'-biphenyl]-4-yl)methyl)amino)-3-nitrobenzoate](https://img.chemicalbook.com/CAS/GIF/139481-28-0.gif)
