BD9594355
2,2,3,3-Tetrafluorosuccinicacid , 98% , 377-38-8
CAS NO.:377-38-8
Empirical Formula: C4H2F4O4
Molecular Weight: 190.05
MDL number: MFCD00042430
EINECS: 206-820-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB86.40 | In Stock |
|
| 5g | RMB324.00 | In Stock |
|
| 25g | RMB1588.00 | In Stock |
|
| 100g | RMB5714.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-118 °C(lit.) |
| Boiling point: | 150°C 15mm |
| Density | 1,4 g/cm3 |
| Flash point: | 150°C/15mm |
| Water Solubility | almost transparency in Water |
| pka | -1.03±0.28(Predicted) |
| form | powder to crystaline |
| color | White to Orange to Green |
| BRN | 1790197 |
| InChI | InChI=1S/C4H2F4O4/c5-3(6,1(9)10)4(7,8)2(11)12/h(H,9,10)(H,11,12) |
| InChIKey | YUDUFRYTKFGQCL-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(F)(F)C(F)(F)C(O)=O |
| CAS DataBase Reference | 377-38-8(CAS DataBase Reference) |
| EPA Substance Registry System | Butanedioic acid, 2,2,3,3-tetrafluoro- (377-38-8) |
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Warning |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| RTECS | WN0725000 |
| F | 3 |
| Hazard Note | Corrosive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29171900 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |




