BD9602447
Dichloro[(R)-(+)-2,2'-bis(diphenylphosphino)-1,1'-binaphathyl]ruthenium(II) , 98% , 132071-87-5
Synonym(s):
(R)-[1,1′-Binaphthalene]-2,2′-diylbis[diphenylphosphine]ruthenium complex;(R)-BINAP dichlororuthenium complex;[(R)-[1,1′-Binaphthalene]-2,2′-diylbis[diphenylphosphine-κP]]dichloro-ruthenium
CAS NO.:132071-87-5
Empirical Formula: C44H32Cl2P2Ru
Molecular Weight: 794.65
MDL number: MFCD01073794
EINECS: 623-973-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB46.40 | In Stock |
|
| 250mg | RMB73.60 | In Stock |
|
| 1g | RMB231.20 | In Stock |
|
| 5g | RMB938.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 ºC |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Powder |
| color | orange |
| Sensitive | air sensitive |
| InChIKey | YEKBVMDAGDTOQB-UHFFFAOYSA-L |
| SMILES | C1(C2C3C=CC=CC=3C=CC=2P(C2=CC=CC=C2)C2=CC=CC=C2)C2C=CC=CC=2C=CC=1P(C1=CC=CC=C1)C1C=CC=CC=1.[Ru](Cl)Cl |
Description and Uses
(R)?-?[2,?2''-?Bis(diphenylphosphin?o)?-?1,?1''-?binaphthyl]?dichlororuthenium is a catalyst used in the synthesis of helicobacter pylori lipopolysaccharide structures displaying anti-inflammatory activiy.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-36/37 |
| HS Code | 2931.90.6000 |

![Dichloro[(R)-(+)-2,2'-bis(diphenylphosphino)-1,1'-binaphathyl]ruthenium(II)](https://img.chemicalbook.com/CAS/GIF/132071-87-5.gif)

![(S)-[2,2′-Bis(diphenylphosphino)-1,1′-binaphthyl]dichlororuthenium](https://img.chemicalbook.com/CAS/GIF/134524-84-8.gif)

![[1,1′-Bis(diphenylphosphino)ferrocene]dichloropalladium](https://img.chemicalbook.com/CAS/GIF/72287-26-4.gif)
![[1,2-Bis(diphenylphosphino)ethane]dichloropalladium(II)](https://img.chemicalbook.com/CAS/GIF/19978-61-1.gif)