BD9602855
3-(Diethylamino)propylisothiocyanate , 98% , 2626-52-0
CAS NO.：2626-52-0
Empirical Formula: C8H16N2S
Molecular Weight: 172.29
MDL number: MFCD00041133
EINECS: 624-868-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB143.20 | In Stock |
|
| 5g | RMB425.60 | In Stock |
|
| 25g | RMB1959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 95 °C |
| Density | 0.954 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| pka | 10.14±0.25(Predicted) |
| Specific Gravity | 0.95 |
| Sensitive | Moisture Sensitive |
| BRN | 1757446 |
| InChI | InChI=1S/C8H16N2S/c1-3-10(4-2)7-5-6-9-8-11/h3-7H2,1-2H3 |
| InChIKey | QPBVKSLJBRCKIF-UHFFFAOYSA-N |
| SMILES | C(N(CC)CC)CCN=C=S |
| CAS DataBase Reference | 2626-52-0(CAS DataBase Reference) |
Description and Uses
3-(Diethylamino)propyl isothiocyanate (DEAP) may be used to synthesize GCS-g-DEAP [glycol chitosan (GCS) grafted with DEAP groups].
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39 |
| RIDADR | 2927 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29309090 |
