BD9603647
1,2-Bis(phenylsulfinyl)ethanepalladium(II)acetate , 97% , 858971-43-4
Synonym(s):
White catalyst
CAS NO.:858971-43-4
Empirical Formula: C14H14O2S2.C4H6O4Pd
Molecular Weight: 502.902
MDL number: MFCD09842752
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB352.00 | In Stock |
|
| 250mg | RMB526.40 | In Stock |
|
| 1g | RMB1314.40 | In Stock |
|
| 5g | RMB5941.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C |
| solubility | soluble in Chloroform |
| form | Powder |
| color | orange to brown |
| Stability: | store cold |
| InChI | 1S/C14H14O2S2.2C2H4O2.Pd/c15-17(13-7-3-1-4-8-13)11-12-18(16)14-9-5-2-6-10-14;2*1-2(3)4;/h1-10H,11-12H2;2*1H3,(H,3,4);/q;;;+2/p-2 |
| InChIKey | SNNYSJNYZJXIFE-UHFFFAOYSA-L |
| SMILES | CC(=O)O[Pd]OC(C)=O.O=S(CCS(=O)c1ccccc1)c2ccccc2 |
Description and Uses
Efficient bis-sulfoxide-Pd(II) catalyst for intramolecular allylic C–H oxidation, sequential allylic C–H oxidation/vinylic C–H arylation, and allylic C–H amination.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 2930.90.2900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 |




