BD9627131
2-Fluoro-5-((3-oxoisobenzofuran-1(3H)-ylidene)methyl)benzonitrile , 97% , 763114-25-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB60.80 | In Stock |
|
| 5g | RMB215.20 | In Stock |
|
| 25g | RMB684.80 | In Stock |
|
| 100g | RMB2445.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 164-167 °C |
| Boiling point: | 430.1±45.0 °C(Predicted) |
| Density | 1.38 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Dichloromethane, Tetrahydrofuran |
| form | Solid |
| color | White |
| InChI | InChI=1S/C16H8FNO2/c17-14-6-5-10(7-11(14)9-18)8-15-12-3-1-2-4-13(12)16(19)20-15/h1-8H |
| InChIKey | MMPHWTMMVPBHRZ-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC(C=C2C3=C(C=CC=C3)C(=O)O2)=CC=C1F |
Description and Uses
2-Fluoro-5-[(3-oxo-1(3H)-isobenzofuranylidene)methyl]-benzonitrile is intermediate in the preparation of poly (ADP-ribose) polymerase (PARP) inhibitors. Olaparib intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| HS Code | 2932990090 |







