BD9635155
2,5-Bis(phenylamino)terephthalicacid , 97% , 10109-95-2
CAS NO.:10109-95-2
Empirical Formula: C20H16N2O4
Molecular Weight: 348.35
MDL number: MFCD00044044
EINECS: 233-302-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB231.20 | In Stock |
|
| 250mg | RMB392.80 | In Stock |
|
| 1g | RMB1060.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 308-312 °C (decomp) |
| Boiling point: | 559.8±50.0 °C(Predicted) |
| Density | 1.412±0.06 g/cm3(Predicted) |
| pka | 2.79±0.36(Predicted) |
| form | Powder |
| InChI | InChI=1S/C20H16N2O4/c23-19(24)15-12-18(22-14-9-5-2-6-10-14)16(20(25)26)11-17(15)21-13-7-3-1-4-8-13/h1-12,21-22H,(H,23,24)(H,25,26) |
| InChIKey | ZJQZWNLKRBUEKX-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=CC(NC2=CC=CC=C2)=C(C(O)=O)C=C1NC1=CC=CC=C1 |
| LogP | 2.02 at 23℃ and pH7 |
| EPA Substance Registry System | 2,5-Dianilinoterephthalic acid (10109-95-2) |
Description and Uses
2,5-DIANILINOTEREPHTHALIC ACID is used as a ligand in the synthesis of MOF materials.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| TSCA | TSCA listed |
| REACH Registrations | Active |





