BD9643747
4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecanoicacid , 98% , 34598-33-9
Synonym(s):
2H,2H,3H,3H-Perfluoroundecanoic acid
CAS NO.:34598-33-9
Empirical Formula: C11H5F17O2
Molecular Weight: 492.13
MDL number: MFCD04038353
EINECS: 252-108-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB173.60 | In Stock |
|
| 1g | RMB467.20 | In Stock |
|
| 5g | RMB1632.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93-97 °C |
| Boiling point: | 244.9±35.0 °C(Predicted) |
| Density | 1.652±0.06 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly, Heated), Methanol (Slightly) |
| pka | 4.22±0.10(Predicted) |
| form | Solid |
| color | White to Off-Whiite |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C11H5F17O2/c12-4(13,2-1-3(29)30)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)28/h1-2H2,(H,29,30) |
| InChIKey | JZRCRCFPVAXHHQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 34598-33-9(CAS DataBase Reference) |
| EPA Substance Registry System | 8:3 Fluorotelomer carboxylic acid (34598-33-9) |
Description and Uses
4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecanoic Acid is a derivative of Undecanoic Acid (U788850) which is a saturated fatty acid. It may be used to activate orphan G protein-coupled receptor GPR40.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H332-H318-H351-H360D-H362-H372 |
| Precautionary statements | P260-P263-P280-P304+P340+P312-P305+P351+P338-P308+P313 |
| target organs | Liver |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Corrosive |
| HS Code | 2915.90.1800 |
| HazardClass | IRRITANT |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Lact. Repr. 1B STOT RE 1 |







