BD9651255
(Chloromethyl)ethenyl-Benzene , 95%mixtureofisomers , 30030-25-2
CAS NO.:30030-25-2
Empirical Formula: C9H9Cl
Molecular Weight: 152.62
MDL number: MFCD00051362
EINECS: 250-005-9
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 25g | RMB78.40 | In Stock |
|
| 100g | RMB309.60 | In Stock |
|
| 500g | RMB1160.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -30°C |
| Boiling point: | 229 °C(lit.) |
| Density | 1.074 g/mL at 25 °C(lit.) |
| vapor density | 5.3 (vs air) |
| vapor pressure | 1 mm Hg ( 56.1 °C) |
| refractive index | n |
| Flash point: | 221 °F |
| storage temp. | -20°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly) |
| form | Liquid |
| Water Solubility | 24.6mg/L at 20℃ |
| FreezingPoint | -30 |
| BRN | 2204384 |
| Stability: | Air Sensitive, Light Sensitive |
| InChI | 1S/2C9H9Cl/c1-2-8-3-5-9(7-10)6-4-8;1-2-8-4-3-5-9(6-8)7-10/h2*2-6H,1,7H2 |
| InChIKey | SLBOQBILGNEPEB-UHFFFAOYSA-N |
| SMILES | ClCc1ccc(C=C)cc1.ClCc2cccc(C=C)c2 |
| LogP | 3.5 at 30℃ |
| CAS DataBase Reference | 30030-25-2(CAS DataBase Reference) |
| EPA Substance Registry System | Benzene, (chloromethyl)ethenyl- (30030-25-2) |
Description and Uses
Vinylbenzyl chloride can be used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H311+H331-H315-H317-H319-H410 |
| Precautionary statements | P273-P280-P301+P312-P302+P352+P312-P304+P340+P311-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34-43 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 3 |
| WGK Germany | 3 |
| F | 8-19 |
| Autoignition Temperature | 1139 °F |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |




