BD9696755
5-(3-Chlorophenyl)furan-2-carbaldehyde , 98% , 22078-59-7
Synonym(s):
5-(3-Chlorophenyl)-2-furancarboxaldehyde
| Pack Size | Price | Stock | Quantity |
| 1g | RMB30.40 | In Stock |
|
| 5g | RMB110.40 | In Stock |
|
| 25g | RMB340.00 | In Stock |
|
| 100g | RMB1103.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 109-111 °C(lit.) |
| Boiling point: | 354.7±32.0 °C(Predicted) |
| Density | 1.282±0.06 g/cm3(Predicted) |
| InChI | 1S/C11H7ClO2/c12-9-3-1-2-8(6-9)11-5-4-10(7-13)14-11/h1-7H |
| InChIKey | FIGLPGGFAIZKFQ-UHFFFAOYSA-N |
| SMILES | Clc1cccc(c1)-c2ccc(C=O)o2 |
| CAS DataBase Reference | 22078-59-7(CAS DataBase Reference) |
Description and Uses
5-(3-Chlorophenyl)furfural (5-(3-chlorophenyl)-2-furfuraldehyde) was used in the synthesis of (5-(3-chlorophenyl)furfuran-2-yl)methanol.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2932190090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






