BD9696855
9-Ethyl-3-nitro-9H-carbazole , 98% , 86-20-4
CAS NO.:86-20-4
Empirical Formula: C14H12N2O2
Molecular Weight: 240.26
MDL number: MFCD00022215
EINECS: 201-655-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB121.60 | In Stock |
|
| 5g | RMB423.20 | In Stock |
|
| 25g | RMB1480.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128-130 °C (lit.) |
| Boiling point: | 362.3±24.0 °C(Predicted) |
| Density | 1.35 g/cm3 |
| InChI | InChI=1S/C14H12N2O2/c1-2-15-13-6-4-3-5-11(13)12-9-10(16(17)18)7-8-14(12)15/h3-9H,2H2,1H3 |
| InChIKey | WONHLSYSHMRRGO-UHFFFAOYSA-N |
| SMILES | N1(CC)C2=C(C=CC=C2)C2=C1C=CC([N+]([O-])=O)=C2 |
| CAS DataBase Reference | 86-20-4(CAS DataBase Reference) |
| EPA Substance Registry System | 9H-Carbazole, 9-ethyl-3-nitro- (86-20-4) |
Description and Uses
9-Ethyl-3-nitrocarbazole can be prepared from 9-ethyl carbazole via nitration. Its crystals exhibit triclinic crystal system.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |





