BD9721555
3,5-Dinitrobenzamide , 98+% , 121-81-3
Synonym(s):
Nitromide
CAS NO.：121-81-3
Empirical Formula: C7H5N3O5
Molecular Weight: 211.13
MDL number: MFCD00007985
EINECS: 204-499-8
| Pack Size | Price | Stock | Quantity |
| 25g | RMB54.40 | In Stock |
|
| 100g | RMB178.40 | In Stock |
|
| 500g | RMB657.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 183-185 °C (lit.) |
| Boiling point: | 350.8°C (rough estimate) |
| Density | 1.6444 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Store at -20°C |
| solubility | DMSO : ≥ 2.2 mg/mL (10.42 mM) |
| pka | 13.73±0.50(Predicted) |
| form | Solid |
| color | Light yellow to yellow |
| Merck | 14,6612 |
| BRN | 7096825 |
| InChI | 1S/C7H5N3O5/c8-7(11)4-1-5(9(12)13)3-6(2-4)10(14)15/h1-3H,(H2,8,11) |
| InChIKey | UUKWKUSGGZNXGA-UHFFFAOYSA-N |
| SMILES | NC(=O)c1cc(cc(c1)[N+]([O-])=O)[N+]([O-])=O |
| CAS DataBase Reference | 121-81-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Dinitrobenzamide(121-81-3) |
| EPA Substance Registry System | 3,5-Dinitrobenzamide (121-81-3) |
Description and Uses
antibacterial, coccidiostat
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312a-P330-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | CV4752300 |
| HS Code | 29242990 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
