BD9763431
4-Bromo-6-chloro-1H-indole , 95% , 885519-23-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB144.00 | In Stock |
|
| 250mg | RMB297.60 | In Stock |
|
| 1g | RMB908.80 | In Stock |
|
| 5g | RMB4202.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 348.1±22.0 °C(Predicted) |
| Density | 1.772±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 15.17±0.30(Predicted) |
| Appearance | Off-white to gray Solid |
| InChI | InChI=1S/C8H5BrClN/c9-7-3-5(10)4-8-6(7)1-2-11-8/h1-4,11H |
| InChIKey | FWMOVLKMGUEKOT-UHFFFAOYSA-N |
| SMILES | N1C2=C(C(Br)=CC(Cl)=C2)C=C1 |
Description and Uses
4-Bromo-6-chloro-1H-indole is an indole derivative used in pharmaceutical synthesis and experimental research.






