BD9764755
2-Nitro-5-(2-phenylacetamido)benzoicacid , 98% , 52033-70-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB56.80 | In Stock |
|
| 1g | RMB150.40 | In Stock |
|
| 5g | RMB684.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 599.6±50.0 °C(Predicted) |
| Density | 1.446±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | ethanol: 9.80-10.20mg/mL, clear, faintly yellow to yellow |
| form | powder |
| pka | 2.05±0.25(Predicted) |
| Appearance | Light yellow to yellow Solid |
| InChI | 1S/C15H12N2O5/c18-14(8-10-4-2-1-3-5-10)16-11-6-7-13(17(21)22)12(9-11)15(19)20/h1-7,9H,8H2,(H,16,18)(H,19,20) |
| InChIKey | QHVQEQRGDKOHHC-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc(NC(=O)Cc2ccccc2)ccc1[N+]([O-])=O |
Description and Uses
2-Nitro-5-(phenylacetylamino)-benzoic acid, also known as 6-Nitro-3-phenylacetamidobenzoic acid, is a chromogenic analogue of penicillin.
2-Nitro-5-(phenylacetylamino)-benzoic acid is used as a substrate for penicillin amidase, which produces phenylacetic acid and 5-amino-2-nitrobenzoic acid by PGA cleavage. Since 5-amino-2-nitro-benzoic acid is chromogenic, the substrate of 2-Nitro-5-(phenylacetylamino)-benzoic acid provides a convenient way to measure PGA activity.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
