BD9767355
2,2-Diphenylacetylchloride , 95% , 1871-76-7
CAS NO.：1871-76-7
Empirical Formula: C14H11ClO
Molecular Weight: 230.69
MDL number: MFCD00013655
EINECS: 217-493-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB100.00 | In Stock |
|
| 25g | RMB286.40 | In Stock |
|
| 100g | RMB1012.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 49-53 °C (lit.) |
| Boiling point: | 175-176 °C/17 mmHg (lit.) |
| Density | 1.1223 (rough estimate) |
| refractive index | 1.5260 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Store below +30°C. |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Crystalline Powder |
| color | Slightly yellow |
| Sensitive | Moisture Sensitive |
| Merck | 14,3316 |
| BRN | 1211588 |
| InChI | InChI=1S/C14H11ClO/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H |
| InChIKey | MSYLETHDEIJMAF-UHFFFAOYSA-N |
| SMILES | C(C(Cl)=O)(C1C=CC=CC=1)C1=CC=CC=C1 |
| CAS DataBase Reference | 1871-76-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Diphenylacetyl chloride(1871-76-7) |
Description and Uses
Diphenylacetyl chloride was used as a reagent in regioselective acylation of cyclomalto-oligosaccharides. It was also used in the preparation of N-substituted amides having local anesthetic properties.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H303-H318-H314 |
| Precautionary statements | P260h-P301+P330+P331-P405-P501a-P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 34-36/37 |
| Safety Statements | 26-27-28-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 2 |
| RTECS | AO6750000 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163900 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
