PRODUCT Properties
| Boiling point: | 120 °C(Press: 10-15 Torr) |
| Density | 1.205±0.06 g/cm3(Predicted) |
| storage temp. | -20 ℃ |
| pka | 16.75±0.30(Predicted) |
| InChI | InChI=1S/C10H9NO/c12-6-5-8-7-11-10-4-2-1-3-9(8)10/h1-4,6-7,11H,5H2 |
| InChIKey | WHOOUMGHGSPMGR-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C(CC=O)=C1 |
Description and Uses
2-(1H-indol-3-yl)acetaldehyde is an indole acetaldehyde compound. It can be produced by substitution of the methyl hydrogen on the acetaldehyde by the indol-3-yl group. It is also an intermediate metabolite in the metabolism of tryptophan.
Tryptaldehyde is used as plasma metabolite biomarker related to secondary hyperparathyroidism and parathyroid hormone.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
