PRODUCT Properties
| Melting point: | 267-270 °C (lit.) |
| Boiling point: | 367.2±42.0 °C(Predicted) |
| Density | 1.421±0.06 g/cm3(Predicted) |
| pka | 2.40±0.20(Predicted) |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C11H8O4/c1-6-2-3-9-7(4-6)8(12)5-10(15-9)11(13)14/h2-5H,1H3,(H,13,14) |
| InChIKey | RKIDLZFIIVDZNX-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)OC2=CC=C(C)C=C2C(=O)C=1 |
| CAS DataBase Reference | 5006-44-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29329990 |




![Sodium9-ethyl-4,6-dioxo-10-propyl-6,9-dihydro-4H-pyrano[3,2-g]quinoline-2,8-dicarboxylate](https://img.chemicalbook.com/CAS/GIF/69049-74-7.gif)


