BD9830631
5-Chloro-N-methylpyridin-2-amine , 97% , 4214-80-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB84.80 | In Stock |
|
| 250mg | RMB122.40 | In Stock |
|
| 1g | RMB305.60 | In Stock |
|
| 5g | RMB1280.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 63-65°C |
| Boiling point: | 247℃ |
| Density | 1.250 |
| Flash point: | 103℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO, Methanol |
| form | Solid |
| pka | 5.00±0.10(Predicted) |
| color | Off-White |
| InChI | InChI=1S/C6H7ClN2/c1-8-6-3-2-5(7)4-9-6/h2-4H,1H3,(H,8,9) |
| InChIKey | KSISYWKRGRATSK-UHFFFAOYSA-N |
| SMILES | C1(NC)=NC=C(Cl)C=C1 |
Description and Uses
5-Chloro-2-methylaminopyridine is used in the preparation of aminosulfuranes with N-heterocyclic groups.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| HS Code | 2933399990 |



![6-(5-Chloro-2-Pyridyl)-5H-Pyrrolo[3,4-b]Pyrazine-5,7(6H)-Dione](https://img.chemicalbook.com/CAS/GIF/43200-82-4.gif)
![6-Chloro-1H-imidazo[4,5-b]pyridin-2(3H)-one](https://img.chemicalbook.com/CAS/GIF/304861-88-9.gif)

![1-[5-CHLORO-3-(TRIFLUOROMETHYL)-2-PYRIDYL]-1-METHYLHYDRAZINE](https://img.chemicalbook.com/CAS/GIF/175205-60-4.gif)
