BD9833731
Boc-Dap , 95% , 120205-50-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB270.40 | In Stock |
|
| 250mg | RMB450.40 | In Stock |
|
| 1g | RMB1123.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 397.8±17.0 °C(Predicted) |
| Density | 1.133±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | Oil |
| pka | 4.27±0.11(Predicted) |
| color | Colorless to light yellow |
| InChI | InChI=1/C14H25NO5/c1-9(12(16)17)11(19-5)10-7-6-8-15(10)13(18)20-14(2,3)4/h9-11H,6-8H2,1-5H3,(H,16,17)/t9-,10+,11-/s3 |
| InChIKey | LNEHHTWYEBGHBY-IPRVUQMJNA-N |
| SMILES | C1N(C(=O)OC(C)(C)C)[C@H]([C@H](OC)[C@@H](C)C(=O)O)CC1 |&1:9,10,13,r| |
| CAS DataBase Reference | 120205-50-7 |
Description and Uses
(2R,3R)-BOC-dolaproine is an β-methoxy-γ-amino acid component of dolastatin 10, an antineoplastic agent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2933998090 |






