BD9855031
(2,3-Dimethylphenyl)(1H-imidazol-4-yl)methanone , 98% , 91874-85-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB380.00 | In Stock |
|
| 250mg | RMB611.20 | In Stock |
|
| 1g | RMB1528.80 | In Stock |
|
| 5g | RMB3928.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 412.7±33.0 °C(Predicted) |
| Density | 1.166±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 10.30±0.10(Predicted) |
| color | White to Pale Brown |
| InChI | InChI=1S/C12H12N2O/c1-8-4-3-5-10(9(8)2)12(15)11-6-13-7-14-11/h3-7H,1-2H3,(H,13,14) |
| InChIKey | RXMJMOMMINVJMY-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC(C)=C1C)(C1NC=NC=1)=O |
Description and Uses
(2,3-Dimethylphenyl)-1H-imidazol-5-ylmethanone was used for tandem addition reduction to synthesize 4(5)?-?[1-?(2,?3-?dimethylphenyl)?-?1H-?imidazole, the α2-?adrenergic agonist medetomidine.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
