BD9867747
Methyl5-(2,4-dichlorophenoxy)-2-nitrobenzoate , 98% , 42576-02-3
Synonym(s):
Methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate
CAS NO.:42576-02-3
Empirical Formula: C14H9Cl2NO5
Molecular Weight: 342.13
MDL number: MFCD00055314
EINECS: 255-894-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB122.40 | In Stock |
|
| 250mg | RMB204.00 | In Stock |
|
| 1g | RMB548.80 | In Stock |
|
| 5g | RMB2168.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 84-86° |
| Boiling point: | 421.0±45.0 °C(Predicted) |
| Density | 1.5715 (rough estimate) |
| refractive index | 1.7350 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| Appearance | Off-white to light yellow Solid |
| Water Solubility | 0.5mg/L(temperature not stated) |
| Merck | 13,1214 |
| BRN | 2170169 |
| Major Application | agriculture environmental |
| InChI | 1S/C14H9Cl2NO5/c1-21-14(18)10-7-9(3-4-12(10)17(19)20)22-13-5-2-8(15)6-11(13)16/h2-7H,1H3 |
| InChIKey | SUSRORUBZHMPCO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Oc2ccc(Cl)cc2Cl)ccc1[N+]([O-])=O |
| LogP | 4.480 |
| CAS DataBase Reference | 42576-02-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Methyl 5-(2,4-dichlorophenoxy)-2-nitrobenzoate(42576-02-3) |
| EPA Substance Registry System | Bifenox (42576-02-3) |
Description and Uses
Selective preemergence or postemergence herbicide used to effectively control a wide variety of broad-leaved weeds (such as bindweed, jimsonweed, kochia, mustards, pigweeds, sesbania, smartweed and velvet-leaf) in tolerant crops (corn, grain sorghum, maize, rice and soybeans).
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | DG7890000 |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 42576-02-3(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats, mice: >6400, 4556 mg/kg; LC50 in pheasants, wild ducks: >5000 ppm (Kruger) |



