BD9899231
tert-Butyl 3,6-diazabicyclo[3.1.1]heptane-3-carboxylate , 98% , 1251017-66-9
CAS NO.:1251017-66-9
Empirical Formula: C10H18N2O2
Molecular Weight: 198.26
MDL number: MFCD17016735
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB86.40 | In Stock |
|
| 250mg | RMB157.60 | In Stock |
|
| 1g | RMB437.60 | In Stock |
|
| 5g | RMB1582.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 276.4±15.0 °C(Predicted) |
| Density | 1.104±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 9.74±0.20(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C10H18N2O2/c1-10(2,3)14-9(13)12-5-7-4-8(6-12)11-7/h7-8,11H,4-6H2,1-3H3 |
| InChIKey | FCRTVZBUJDHXNR-UHFFFAOYSA-N |
| SMILES | C12CC(N1)CN(C(OC(C)(C)C)=O)C2 |
Description and Uses
tert-Butyl 3,6-Diazabicyclo[3.1.1]heptane-3-carboxylate is used as a reactant in the synthesis of benzazepine dicarboxamide compounds as TLR8 agonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H413 |
| Precautionary statements | P261-P305+P351+P338 |

![tert-Butyl 3,6-diazabicyclo[3.1.1]heptane-3-carboxylate](https://img.chemicalbook.com/CAS/20150408/GIF/1251017-66-9.gif)

![tert-Butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate](https://img.chemicalbook.com/CAS/GIF/173405-78-2.gif)
![tert-Butyl3,9-diazabicyclo[3.3.1]nonane-9-carboxylate](https://img.chemicalbook.com/CAS/20180703/GIF/941295-31-4.gif)