BD9915255
1-(4-Bromophenyl)-4-chlorobutan-1-one , 98% , 4559-96-0
CAS NO.：4559-96-0
Empirical Formula: C10H10BrClO
Molecular Weight: 261.54
MDL number: MFCD00001006
EINECS: 224-930-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB67.20 | In Stock |
|
| 5g | RMB233.60 | In Stock |
|
| 25g | RMB817.60 | In Stock |
|
| 100g | RMB2697.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 35.5-38 °C(lit.) |
| Boiling point: | 150-157 °C(Press: 6.5 Torr) |
| Density | 1.4780 (rough estimate) |
| refractive index | 1.5963 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Storage temp. 2-8°C |
| Appearance | Colorless to light yellow <35°C Solid,>38°C Liquid |
| Water Solubility | Insoluble in water. |
| InChI | InChI=1S/C10H10BrClO/c11-9-5-3-8(4-6-9)10(13)2-1-7-12/h3-6H,1-2,7H2 |
| InChIKey | WJKPUMBLABGUCQ-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(Br)C=C1)(=O)CCCCl |
Description and Uses
4'-Bromo-4-chlorobutyrophenone is used as a pharmaceutical & syntheses material intermediates.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
