BD9920655
2,6-Dichloro-1,4-benzoquinone , 98% , 697-91-6
CAS NO.:697-91-6
Empirical Formula: C6H2Cl2O2
Molecular Weight: 176.98
MDL number: MFCD00037159
EINECS: 211-810-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB167.20 | In Stock |
|
| 5g | RMB608.00 | In Stock |
|
| 25g | RMB2356.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 122-124 °C(lit.) |
| Boiling point: | 251.81°C (rough estimate) |
| Density | 1.5138 (rough estimate) |
| refractive index | 1.4595 (estimate) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Dark Yellow |
| Water Solubility | Insoluble in water. Solubility in methanol (almost transparency). |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C6H2Cl2O2/c7-4-1-3(9)2-5(8)6(4)10/h1-2H |
| InChIKey | JCARTGJGWCGSSU-UHFFFAOYSA-N |
| SMILES | C1(=O)C(Cl)=CC(=O)C=C1Cl |
| CAS DataBase Reference | 697-91-6(CAS DataBase Reference) |
| EPA Substance Registry System | 2,5-Cyclohexadiene-1,4-dione, 2,6-dichloro- (697-91-6) |
Description and Uses
2,6-Dichloro-1,4-benzoquinone is the suitable reagent used to in a study to evaluate the diffusion coefficients (D) for a family of quinones, nitroaromatics, ferrocenes and aromatic hydrocarbon compounds, in acetonitrile by single potential step chronoamperometry.1 It may be used in the preparation of 2,3,5-Trichloro-1,4-dihydroquinone, 2,3,5-trichloro-1,4-benzoquinone and 2,6-Dichloro-1,4-dihydroquinone.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | DK4000000 |
| TSCA | TSCA listed |
| HS Code | 2914698090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




