BD9921555
Benzeneseleninicacidanhydride , 98% , 17697-12-0
CAS NO.:17697-12-0
Empirical Formula: C12H10O3Se2
Molecular Weight: 360.13
MDL number: MFCD00001991
EINECS: 241-701-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB92.00 | In Stock |
|
| 1g | RMB228.80 | In Stock |
|
| 5g | RMB772.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-170 °C (lit.) |
| Boiling point: | 184.2±23.0 °C(Predicted) |
| storage temp. | RT, stored under nitrogen |
| form | solid |
| Appearance | White to off-white Solid |
| Sensitive | Moisture Sensitive |
| BRN | 2332406 |
| InChI | InChI=1S/C12H10O3Se2/c13-16(11-7-3-1-4-8-11)15-17(14)12-9-5-2-6-10-12/h1-10H |
| InChIKey | FHPZOWOEILXXBD-UHFFFAOYSA-N |
| SMILES | C1([Se](O[Se](C2=CC=CC=C2)=O)=O)=CC=CC=C1 |
| CAS DataBase Reference | 17697-12-0(CAS DataBase Reference) |
Description and Uses
Benzeneseleninic acid anhydride was used to oxidize hydrazines to afford azo-compounds.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H331-H373-H410 |
| Precautionary statements | P273-P301+P310+P330-P304+P340+P311-P314 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,N |
| Risk Statements | 23/25-33-50/53 |
| Safety Statements | 20/21-28-45-60-61 |
| RIDADR | UN 3283 6.1/PG 2 |
| WGK Germany | 3 |
| F | 3-10-21 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29310099 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 |







