BD9942831
Methyl 4-aminopyridine-2-carboxylate , 97% , 71469-93-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB44.00 | In Stock |
|
| 1g | RMB113.60 | In Stock |
|
| 5g | RMB362.40 | In Stock |
|
| 10g | RMB591.20 | In Stock |
|
| 25g | RMB1184.80 | In Stock |
|
| 100g | RMB4612.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 129-130° |
| Boiling point: | 333.7±22.0 °C(Predicted) |
| Density | 1.238±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 4.35±0.10(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C7H8N2O2/c1-11-7(10)6-4-5(8)2-3-9-6/h2-4H,1H3,(H2,8,9) |
| InChIKey | YHOVYZINCVIRGK-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=NC=CC(N)=C1 |
Description and Uses
Methyl 4-aminopyridine-2-carboxylate is an organic reagent, mostly used in chemical manufacturing and scientific experimental research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| RIDADR | UN2811 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
