BD9946631
4-Bromobenzo[b]thiophene-2-carboxylic acid , 98% , 5194-37-6
CAS NO.:5194-37-6
Empirical Formula: C9H5BrO2S
Molecular Weight: 257.1
MDL number: MFCD03407342
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB75.20 | In Stock |
|
| 1g | RMB156.00 | In Stock |
|
| 5g | RMB566.40 | In Stock |
|
| 10g | RMB969.60 | In Stock |
|
| 25g | RMB2057.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 265 |
| Boiling point: | 429.7±25.0 °C(Predicted) |
| Density | 1.813±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| form | powder |
| pka | 3.27±0.30(Predicted) |
| color | White |
| InChI | InChI=1S/C9H5BrO2S/c10-6-2-1-3-7-5(6)4-8(13-7)9(11)12/h1-4H,(H,11,12) |
| InChIKey | LAYNZUFIYSYHIV-UHFFFAOYSA-N |
| SMILES | C12=CC=CC(Br)=C1C=C(C(O)=O)S2 |
Description and Uses
4-BROMO-BENZO[B]THIOPHENE-2-CARBOXYLIC ACID can be used as a key intermediate in the synthesis of pharmaceuticals. It has potentially biological activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2934999090 |

![4-Bromobenzo[b]thiophene-2-carboxylic acid](https://img.chemicalbook.com/CAS/GIF/5194-37-6.gif)

![Methyl 4-bromobenzo[b]thiophene-2-carboxylate](https://img.chemicalbook.com/CAS/GIF/360575-29-7.gif)
![4-Bromobenzo[b]thiophene](https://img.chemicalbook.com/CAS/GIF/5118-13-8.gif)

