3,5,7-Trihydroxy-2-(3,4,5-trihydroxyphenyl)chromenyliumchloride , 98% , 528-53-0
Synonym(s):
3,3′,4′,5,5′,7-Hexahydroxyflavylium chloride;3,5,7-Trihydroxy-2-(3,4,5-trihydroxyphenyl)-1-benzopyrylium chloride
CAS NO.:528-53-0
Empirical Formula: C15H11ClO7
Molecular Weight: 338.7
MDL number: MFCD00016663
EINECS: 208-437-0
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB8736.00 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | >349.85°C |
| Boiling point: | 454.94°C (rough estimate) |
| Density | 1.3946 (rough estimate) |
| refractive index | 1.4429 (estimate) |
| storage temp. | −20°C |
| solubility | Methanol (Slightly) |
| form | Solid |
| color | Blue-Red to Black |
| InChI | InChI=1S/C15H10O7.ClH/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6;/h1-5H,(H5-,16,17,18,19,20,21);1H |
| InChIKey | FFNDMZIBVDSQFI-UHFFFAOYSA-N |
| SMILES | C1(=C(O)C=C2C(O)=CC(O)=CC2=[O+]1)C1=CC(=C(O)C(O)=C1)O.[Cl-] |
Description and Uses
Delphinidin (chloride) is an anthocyanidin, a natural plant pigment which serves as the precursor of certain anthocyanins that provide the blue-
Delphinidin Chloride is an anthocyanidin; antioxidant. Delphinidin Chloride is a pigment found in grapes, cranberries, and pomegranates.
Safety
| WGK Germany | 3 |
| RTECS | DK1310000 |
| F | 10-21 |
| HS Code | 29072990 |






