BD9950031
2-(2,6-Dioxopiperidin-3-yl)-4-nitroisoindoline-1,3-dione , 97% , 19171-18-7
CAS NO.：19171-18-7
Empirical Formula: C13H9N3O6
Molecular Weight: 303.23
MDL number:
EINECS: 200-258-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB24.00 | In Stock |
|
| 250mg | RMB31.20 | In Stock |
|
| 1g | RMB69.60 | In Stock |
|
| 5g | RMB245.60 | In Stock |
|
| 25g | RMB1122.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >200°C (dec.) |
| Boiling point: | 603.4±50.0 °C(Predicted) |
| Density | 1.651±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Acetonitrile (Slightly, Heated, Sonicated), DMSO (Slightly) |
| pka | 10.55±0.40(Predicted) |
| form | Solid |
| color | Pale Yellow to Pale Beige |
| InChI | InChI=1S/C13H9N3O6/c17-9-5-4-8(11(18)14-9)15-12(19)6-2-1-3-7(16(21)22)10(6)13(15)20/h1-3,8H,4-5H2,(H,14,17,18) |
| InChIKey | KVRCAGKHAZRSQX-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C([N+]([O-])=O)=CC=C2)C(=O)N1C1CCC(=O)NC1=O |
Description and Uses
4-Nitrothalidomide is a compound involved in the preparation of Pomalidomide (P688200), a thalidomide derivative and potent inhibitor of TNF-α production.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
