BD9951555
(1S,4S)-2-Benzyl-2,5-diazabicyclo[2.2.1]heptanedihydrobromide , 95% , 116258-17-4
CAS NO.:116258-17-4
Empirical Formula: C12H18Br2N2
Molecular Weight: 350.09
MDL number: MFCD01321292
| Pack Size | Price | Stock | Quantity |
| 1g | RMB648.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 270 °C (dec.)(lit.) |
| alpha | 16.5 º (C=3 IN 2 M NAOH) |
| refractive index | 16 ° (C=3, 2mol/L NaOH) |
| storage temp. | Store at room temperature, keep dry and cool |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]20/D +16.5°, c = 3 in 2 M NaOH |
| Water Solubility | very faint turbidity |
| InChI | 1S/C12H16N2.2BrH/c1-2-4-10(5-3-1)8-14-9-11-6-12(14)7-13-11;;/h1-5,11-13H,6-9H2;2*1H/t11-,12-;;/m0../s1 |
| InChIKey | SOMPEQIPSQFVMO-AQEKLAMFSA-N |
| SMILES | Br.Br.C1N[C@H]2C[C@@H]1N(C2)Cc3ccccc3 |
| CAS DataBase Reference | 116258-17-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |

![(1S,4S)-2-Benzyl-2,5-diazabicyclo[2.2.1]heptanedihydrobromide](https://img.chemicalbook.com/CAS/GIF/116258-17-4.gif)


