BD9953631
Methyl 4-formyl-3-hydroxybenzoate , 95% , 24589-98-8
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB125.60 | In Stock |
|
| 100mg | RMB176.00 | In Stock |
|
| 250mg | RMB356.80 | In Stock |
|
| 1g | RMB899.20 | In Stock |
|
| 5g | RMB2854.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 135-135.5 °C(Solv: ethyl acetate (141-78-6)) |
| Boiling point: | 324.1±27.0 °C(Predicted) |
| Density | 1.310±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 7.36±0.10(Predicted) |
| Appearance | Off-white to yellow Solid |
| InChI | InChI=1S/C9H8O4/c1-13-9(12)6-2-3-7(5-10)8(11)4-6/h2-5,11H,1H3 |
| InChIKey | OMCTZIDLDSYPOA-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(C=O)C(O)=C1 |
Description and Uses
4-Carbomethoxysalicylaldehyde is used in the preparation of α-glucosidase inhibitors. Also used in the preparation of β-lactamase substrates.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319-H315-H335 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
