BD9956655
Sodium(2S,3S,4S,5R,6R)-6-(((((((2R,3S,4R,5R)-5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methoxy)oxidophosphoryl)oxy)oxidophosphoryl)oxy)-3,4,5-trihydroxytetrahydro-2H-pyran-2-carboxylate , 98% , 63700-19-6
Synonym(s):
UDPGA;UDP-GlcA;Uridine[5′]diphospho[1]-α-D -glucopyranosuronic acid trisodium salt;Uridine-diphosphate-glucuronic acid trisodium salt
CAS NO.：63700-19-6
Empirical Formula: C15H19N2Na3O18P2
Molecular Weight: 646.23
MDL number: MFCD03452710
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB584.00 | In Stock |
|
| 50mg | RMB934.40 | In Stock |
|
| 100mg | RMB1494.40 | In Stock |
|
| 250mg | RMB2540.00 | In Stock |
|
| 1g | RMB6857.60 | In Stock |
|
| 5g | RMB29600.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >175oC (dec.) |
| storage temp. | -20°C |
| solubility | H2O: 10 mg/mL, clear, colorless |
| form | Solid |
| color | White to Off-WHite |
| biological source | bovine liver rabbit muscle yeast |
| Stability: | Hygroscopic |
| InChIKey | SLLHKYVCELYFCN-UBOOCJFONA-N |
| SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP(O)(=O)O[C@@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](C(=O)O)O2)O)O[C@H]1N1C=CC(=O)NC1=O)O.[NaH] |&1:1,2,3,14,15,16,18,20,27,r| |
Description and Uses
Trisodium UDP-glucuronic Acid is a reactant used in the enzymatic preparation of β-glucuronides.
Safety
| Symbol(GHS) |   GHS07,GHS02 |
| Signal word | Warning |
| Hazard statements | H315-H319-H226 |
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P264-P280-P370+P378-P337+P313-P305+P351+P338-P362+P364-P303+P361+P353-P332+P313-P403+P235 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10-21 |
