BD9999631
5-Methyl-2,2'-bipyridine , 98% , 56100-20-0
CAS NO.：56100-20-0
Empirical Formula: C11H10N2
Molecular Weight: 170.21
MDL number: MFCD08062569
EINECS: 200-258-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB106.40 | In Stock |
|
| 250mg | RMB216.00 | In Stock |
|
| 1g | RMB615.20 | In Stock |
|
| 5g | RMB2377.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 92 °C(Press: 0.05 Torr) |
| Density | 1.081±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DCM |
| form | Light Yellow Liquid |
| pka | 4.39±0.20(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C11H10N2/c1-9-5-6-11(13-8-9)10-4-2-3-7-12-10/h2-8H,1H3 |
| InChIKey | LECLRDWVJRSFSE-UHFFFAOYSA-N |
| SMILES | C1(C2=NC=CC=C2)=NC=C(C)C=C1 |
Description and Uses
5-Methyl-2,2''-bipyridine is an intermediate in the synthesis of genetic incorporation of a metal-ion chelating amino acids into proteins as a biophysical probe.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2933399990 |
