PRODUCT Properties
| Melting point: | 111-115 °C(lit.) |
| Boiling point: | 148 °C5 mm Hg(lit.) |
| Density | 1,18 g/cm3 |
| vapor density | >1 (vs air) |
| Flash point: | >110°C |
| storage temp. | -20°C |
| solubility | Soluble in acetone and benzene. |
| form | crystal |
| color | white |
| Appearance | white crystals |
| Water Solubility | soluble acetone, benzene [MER06] |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Merck | 14,8498 |
| BRN | 994868 |
| InChI | 1S/C8H12O8Si/c1-5(9)13-17(14-6(2)10,15-7(3)11)16-8(4)12/h1-4H3 |
| InChIKey | YZVRVDPMGYFCGL-UHFFFAOYSA-N |
| SMILES | CC(=O)O[Si](OC(C)=O)(OC(C)=O)OC(C)=O |
| CAS DataBase Reference | 562-90-3(CAS DataBase Reference) |
| EPA Substance Registry System | Silicon tetraacetate (562-90-3) |
Description and Uses
Silicon tetraacetate is used in the preparation of silicon dioxide thin films by a direct photochemical vapor deposition method. It serves as a precursor to prepare silicon complexes with monofunctional bidentate Schiff bases. It is also used as an alternative to silicon hydride and alkoxide for low-temperature silicon dioxide production. Further, it reacts with ethanol in the absence of water to get silica gel and ethyl acetate. In addition, it is employed as a sol-gel precursor.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29159000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
