PRODUCT Properties
| Melting point: | -95 °C |
| Boiling point: | 73 °C |
| Density | 2.169 |
| refractive index | 1.3605 |
| Flash point: | 71-72°C |
| Specific Gravity | 2.169 |
| InChI | InChI=1S/C3Br2F6/c4-1(6,2(5,7)8)3(9,10)11 |
| InChIKey | KTULQNFKNLFOHL-UHFFFAOYSA-N |
| SMILES | C(Br)(F)(F)C(Br)(F)C(F)(F)F |
| CAS DataBase Reference | 661-95-0(CAS DataBase Reference) |
| EPA Substance Registry System | Propane, 1,2-dibromo-1,1,2,3,3,3-hexafluoro- (661-95-0) |
Description and Uses
1,2-Dibromohexafluoropropane is used in method of manufacturing fire-extinguishing microcapsules comprising fire-extinguishing agent and polymeric shell.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| RTECS | TX8800000 |
| Hazard Note | Irritant |
| TSCA | Yes |
