F037023
N,N-Diethyl-4-methylbenzamide , 97 , 2728-05-4
Synonym(s):
N,N-Diethyl-4-methylbenzamide;N,N-Diethyl-4-toluamide;p-DEET;NSC 5686
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB1678.40 | In Stock |
|
| 1g | RMB5341.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 53-54 °C |
| Boiling point: | 163 °C(Press: 17 Torr) |
| Density | 0.985±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -0.93±0.70(Predicted) |
| color | White to Off-White |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C12H17NO/c1-4-13(5-2)12(14)11-8-6-10(3)7-9-11/h6-9H,4-5H2,1-3H3 |
| InChIKey | PUZORFQMRDHKBT-UHFFFAOYSA-N |
| SMILES | N(CC)(CC)C(=O)c1ccc(cc1)C |
Description and Uses
N,N-Diethyl-p-toluamide, is a buildig block used in the synthesis of phthalocyanines. It can also be used in preparation of new insect repellents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| WGK Germany | WGK 3 |
| RTECS | XS4025000 |
| HS Code | 2924296000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |