F042923
2-Propanol-d{8} , 99 , 22739-76-0
Synonym(s):
Isopropanol-d8;Octadeuteroisopropanol
CAS NO.:22739-76-0
Empirical Formula: C3H8O
Molecular Weight: 60.1
MDL number: MFCD00044341
EINECS: 245-189-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB3176.80 | In Stock |
|
| 25g | RMB9028.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -89.5°C |
| Melting point: | -89°C |
| Boiling point: | 83°C |
| Boiling point: | 82 °C(lit.) |
| Density | 0.890 g/mL at 25 °C(lit.) |
| Density | d = 0,90 |
| refractive index | n |
| Flash point: | 75 °F |
| storage temp. | Flammables area |
| form | Liquid |
| color | Clear colorless |
| explosive limit | 2-12.7%(V) |
| Water Solubility | Completely soluble in water. |
| BRN | 1816231 |
| Stability: | Stable. Highly flammable. Incompatible with acids, strong oxidizing agents, acid anhydrides, halogens, aluminium. |
| InChI | InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3/i1D3,2D3,3D,4D |
| InChIKey | KFZMGEQAYNKOFK-PIODKIDGSA-N |
| SMILES | C([2H])(O[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Description and Uses
2-Propanol-d{8} is used as an intermediate in chemical research and in pharmaceutics.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H319-H336 |
| Precautionary statements | P210-P305+P351+P338 |
| target organs | Central nervous system |
| Hazard Codes | F,Xi |
| Risk Statements | 11-67-36 |
| Safety Statements | 7-16-26-24/25-2017/7/16 |
| RIDADR | UN 1219 3/PG 2 |
| WGK Germany | 3 |
| F | 3-10 |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 28459000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |




