PRODUCT Properties
| Melting point: | 244 °C (dec.)(lit.) |
| form | solid |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/2C3H9N3.H2O4S/c2*1-2-6-3(4)5;1-5(2,3)4/h2*2H2,1H3,(H4,4,5,6);(H2,1,2,3,4) |
| InChIKey | UKQVDMIAGTYDFN-UHFFFAOYSA-N |
| SMILES | S(O)(O)(=O)=O.C(=N)(N)NCC.C(=N)(N)NCC |
| CAS DataBase Reference | 3482-86-8 |
Description and Uses
1-Ethylguanidine sulfate may be used in chemical synthesis studies.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29252900 |
