F092822
(^+)-2-cis-4-trans-Abscisic acid , 99 , 14375-45-2
Synonym(s):
(±)-Abscisic acid;(2Z,4E)-5-(1-Hydroxy-2,6,6-trimethyl-4-oxo-2-cyclohexen-1-yl)-3-methyl-2,4-pentadienoic acid;ABA;Dormin
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB1361.60 | In Stock |
|
| 250mg | RMB2678.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 186-188 °C (lit.) |
| Boiling point: | 458.7±45.0 °C(Predicted) |
| Density | 1.193±0.06 g/cm3(Predicted) |
| Flash point: | 120°C |
| storage temp. | 2-8°C |
| solubility | methanol: 50 mg/mL, may be clear to slightly hazy |
| pka | 4.87±0.33(Predicted) |
| form | Solid |
| color | White to off-white |
| Sensitive | Light Sensitive |
| Sublimation | 120 ºC |
| Merck | 14,11 |
| BRN | 4142666 |
| InChI | InChI=1S/C15H20O4/c1-10(7-13(17)18)5-6-15(19)11(2)8-12(16)9-14(15,3)4/h5-8,19H,9H2,1-4H3,(H,17,18)/b6-5+,10-7- |
| InChIKey | JLIDBLDQVAYHNE-LXGGSRJLSA-N |
| SMILES | C(O)(=O)/C=C(/C)\C=C\C1(O)C(C)(C)CC(=O)C=C1C |
| CAS DataBase Reference | 14375-45-2(CAS DataBase Reference) |
Description and Uses
Abscisic acid (ABA) is an isoprenoid plant hormone (phytohormone) synthesized in all parts of plants and involved in many plant developmental processes. ABA is involved in establishing dormancy and regulation of stress responses. ABA inhibits fruit ripening, seed germination, photosynthesis and kinetin biosynthesis.



