F138523
Isophthalamidoxime , 97 , 15325-51-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB948.00 | In Stock |
|
| 5g | RMB3776.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C, sealed storage, away from moisture and light |
| form | solid |
| Appearance | White to off-white Solid |
| InChI | 1S/C8H10N4O2/c9-7(11-13)5-2-1-3-6(4-5)8(10)12-14/h1-4,13-14H,(H2,9,11)(H2,10,12) |
| InChIKey | JVXOIYJLJWAUQP-UHFFFAOYSA-N |
| SMILES | N\C(=N\O)c1cccc(c1)\C(N)=N\O |
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | WGK 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |