F175122
1H,1H,2H,2H-Perfluoro-1-dodecanol , 96 , 865-86-1
CAS NO.:865-86-1
Empirical Formula: C12H5F21O
Molecular Weight: 564.13
MDL number: MFCD00039545
EINECS: 212-748-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB731.20 | In Stock |
|
| 5g | RMB1436.80 | In Stock |
|
| 25g | RMB5592.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95 °C |
| Boiling point: | 145 °C |
| Density | 1.664±0.06 g/cm3(Predicted) |
| Flash point: | 145°C/10mm |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly, Heated, Sonicated), Methanol (Slightly, Sonicated) |
| form | Solid |
| pka | 14.28±0.10(Predicted) |
| color | White to Off-White |
| Water Solubility | Insoluble in water. |
| BRN | 2029867 |
| Major Application | PFAS testing clinical testing coatings environmental food and beverages |
| InChIKey | FLXYIZWPNQYPIT-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCO |
| CAS DataBase Reference | 865-86-1(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Dodecanol, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluoro- (865-86-1) |
Description and Uses
1H,1H,2H,2H-Perfluorododecan-1-ol is a fluorotelomer alcohol (FTOH) often detected in indoor dust.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H228-H315-H319-H335 |
| Precautionary statements | P280-P210 |
| target organs | Liver |
| Hazard Codes | F |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | WGK 3 |
| Hazard Note | Flammable |
| TSCA | TSCA listed |
| HS Code | 29055900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Lact. Repr. 1B STOT RE 1 |






