F246722
Tris(2,2,6,6-tetramethyl-3,5-heptanedionato)bismuth(III) , 99.9 , 142617-53-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB422.40 | In Stock |
|
| 1g | RMB771.20 | In Stock |
|
| 5g | RMB3064.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 89-99 °C(lit.) |
| Boiling point: | 295°C |
| Flash point: | 150°C/0.05mm |
| form | crystal |
| color | off-white |
| Water Solubility | Insoluble in water. |
| Sensitive | Hygroscopic |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/3C11H20O2.Bi/c3*1-10(2,3)8(12)7-9(13)11(4,5)6;/h3*7,12H,1-6H3;/q;;;+3/p-3/b3*8-7-; |
| InChIKey | ZNHBPQSSVCRFST-LWTKGLMZSA-K |
| SMILES | C(C)(C)(C)/C(/O[Bi](O/C(=C\C(=O)C(C)(C)C)/C(C)(C)C)O/C(=C\C(=O)C(C)(C)C)/C(C)(C)C)=C/C(=O)C(C)(C)C |
Description and Uses
Used as pharamaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29161995 |



