F311822
p-Tolyltrichlorosilane , 97 , 701-35-9
CAS NO.:701-35-9
Empirical Formula: C7H7Cl3Si
Molecular Weight: 225.57
MDL number: MFCD00045131
EINECS: 211-854-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB463.20 | In Stock |
|
| 25g | RMB3191.20 | In Stock |
|
| 100g | RMB5017.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 218-220 °C (lit.) |
| Density | 1.273 g/mL at 25 °C (lit.) |
| vapor pressure | 0-4220000Pa at 20-25℃ |
| refractive index | n |
| Flash point: | 210 °F |
| storage temp. | Store at room temperature, keep dry and cool |
| form | liquid |
| Specific Gravity | 1.28 |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | Reacts with water. |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | Moisture Sensitive |
| BRN | 1866557 |
| InChI | 1S/C7H7Cl3Si/c1-6-2-4-7(5-3-6)11(8,9)10/h2-5H,1H3 |
| InChIKey | WOMUGKOOLXQCTQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(cc1)[Si](Cl)(Cl)Cl |
| LogP | -0.6 |
| CAS DataBase Reference | 701-35-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Tolyltrichlorosilane(701-35-9) |
| EPA Substance Registry System | Silane, trichloro(4-methylphenyl)- (701-35-9) |
Description and Uses
It can be used to produce 3-(p-Methylphenyl)cyclohexanon.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 14-34 |
| Safety Statements | 23-26-27-36/37/39-45 |
| RIDADR | UN 2987 8/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29319000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |







