PRODUCT Properties
| Density | 2,98 g/cm3 |
| solubility | soluble in H2O; insoluble in ethanol |
| form | white crystals |
| color | white crystals, crystalline |
| Water Solubility | Very slightly soluble in water |
| BRN | 6120238 |
| Exposure limits | ACGIH: TWA 0.5 mg/m3 NIOSH: IDLH 50 mg/m3; TWA 0.5 mg/m3 |
| InChI | InChI=1S/C4H6O6.Ba/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+2/p-2 |
| InChIKey | HQYOWPDUMCBSLQ-UHFFFAOYSA-L |
| SMILES | C1(O)C(=O)O[Ba]OC(=O)C1O |
| LogP | -3.4 at 20℃ and pH7 |
| CAS DataBase Reference | 5908-81-6(CAS DataBase Reference) |
Description and Uses
Pyrotechnics.
