F406021
Bathophenanthrolinedisulfonic acid disodium salt hydrate , 98 , 52746-49-3
Synonym(s):
4,7-Diphenyl-1,10-phenanthroline-disulfonic acid disodium salt trihydrate;Disodium bathophenanthrolinedisulfonate trihydrate
CAS NO.:52746-49-3
Empirical Formula: C24H14N2O6S2.2Na
Molecular Weight: 536.5
MDL number: MFCD00167047
EINECS: 258-152-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB426.40 | In Stock |
|
| 1g | RMB1377.60 | In Stock |
|
| 5g | RMB4866.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 300 °C |
| storage temp. | room temp |
| solubility | H2O: soluble |
| form | Powder |
| color | Slightly pinkish-beige |
| Water Solubility | Soluble in water. |
| InChIKey | WWYNZTCWCJHTJF-UHFFFAOYSA-L |
| SMILES | C1(C2=CC=CC=C2)=C(S([O-])(=O)=O)C=NC2C3N=CC(S([O-])(=O)=O)=C(C4=CC=CC=C4)C=3C=CC1=2.[Na+].[Na+] |
| CAS DataBase Reference | 52746-49-3(CAS DataBase Reference) |
| EPA Substance Registry System | 1,10-Phenanthrolinedisulfonic acid, 4,7-diphenyl-, disodium salt (52746-49-3) |
Description and Uses
Bathophenanthrolinedisulfonic acid disodium salt trihydrate was used in double electrochemical covalent coupling method for the fabrication of sensitive amperometric immunosensor, which was based on electro-click chemistry and diazonium chemistry. It was also used in an experimental study based upon, correlating the iron content with the activity, preparation and reconstituting the apoenzyme phenylamine hydroxylase.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 21/22-36/37/38 |
| Safety Statements | 22-24/25-36/37/39-26 |
| WGK Germany | 3 |
| RTECS | SF8433000 |
| F | 8-10 |
| TSCA | TSCA listed |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |




