F417421
4,4'-Trimethylenebis(1-methylpiperidine) , 98 , 64168-11-2
Synonym(s):
4,4′-(1,3-Propanediyl)bis[1-methyl-piperidine]
CAS NO.:64168-11-2
Empirical Formula: C15H30N2
Molecular Weight: 238.41
MDL number: MFCD00006501
EINECS: 264-717-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB848.80 | In Stock |
|
| 5g | RMB3103.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 13 °C (lit.) |
| Boiling point: | 215 °C/50 mmHg (lit.) |
| Density | 0.896 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| pka | 9.90±0.10(Predicted) |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C15H30N2/c1-16-10-6-14(7-11-16)4-3-5-15-8-12-17(2)13-9-15/h14-15H,3-13H2,1-2H3 |
| InChIKey | JWOTWWORMYMZCR-UHFFFAOYSA-N |
| SMILES | C(C1CCN(C)CC1)CCC1CCN(C)CC1 |
| CAS DataBase Reference | 64168-11-2 |
| NIST Chemistry Reference | 4,4'-Trimethylenebis(1-methylpiperidine)(64168-11-2) |
| EPA Substance Registry System | Piperidine, 4,4'-(1,3-propanediyl)bis[1-methyl- (64168-11-2) |
Description and Uses
4,4′-Trimethylenebis(1-methylpiperidine) has been used in the synthesis of:
- di-, tri- and tetracationic monomeric and homodimeric monomethine cyanine dyes for nucleic acid detection
- structure directing agents containing 4,4′-trimethylenebis(1-methylpiperidine)
- piperidine-based dicationic ionic liquids
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




